About 1,3-dinitrobenzene;3-methoxyphenol
1,3-dinitrobenzene;3-methoxyphenol (PubChem CID 174564755) has the molecular formula C13H12N2O6
and a molecular weight of 292.25 g/mol. Its IUPAC name is 1,3-dinitrobenzene;3-methoxyphenol.
Molecular Properties
| Compound Name | 1,3-dinitrobenzene;3-methoxyphenol |
| PubChem CID | 174564755 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1,3-dinitrobenzene;3-methoxyphenol |
| SMILES | COc1cccc(O)c1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H8O2.C6H4N2O4/c1-9-7-4-2-3-6(8)5-7;9-7(10)5-2-1-3-6(4-5)8(11)12/h2-5,8H,1H3;1-4H |
| InChIKey | ATOKWGLMCHKZCQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dinitrobenzene;3-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dinitrobenzene;3-methoxyphenol?
The IUPAC name of 1,3-dinitrobenzene;3-methoxyphenol (CID 174564755) is 1,3-dinitrobenzene;3-methoxyphenol.
What is the SMILES notation for 1,3-dinitrobenzene;3-methoxyphenol?
The canonical SMILES for 1,3-dinitrobenzene;3-methoxyphenol is COc1cccc(O)c1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 1,3-dinitrobenzene;3-methoxyphenol?
The InChIKey is ATOKWGLMCHKZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C6H4N2O4/c1-9-7-4-2-3-6(8)5-7;9-7(10)5-2-1-3-6(4-5)8(11)12/h2-5,8H,1H3;1-4H.
What are the key properties of 1,3-dinitrobenzene;3-methoxyphenol?
1,3-dinitrobenzene;3-methoxyphenol has a molecular weight of 292.25 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dinitrobenzene;3-methoxyphenol is sourced from PubChem (CID 174564755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).