About sodium 3-methoxyphenol
sodium 3-methoxyphenol (PubChem CID 19079440) has the molecular formula C7H8NaO2+
and a molecular weight of 147.13 g/mol. Its IUPAC name is sodium 3-methoxyphenol.
Molecular Properties
| Compound Name | sodium 3-methoxyphenol |
| PubChem CID | 19079440 |
| Molecular Formula | C7H8NaO2+ |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | sodium 3-methoxyphenol |
| SMILES | COc1cccc(O)c1.[Na+] |
| InChI | InChI=1S/C7H8O2.Na/c1-9-7-4-2-3-6(8)5-7;/h2-5,8H,1H3;/q;+1 |
| InChIKey | IIHZUISTNNNXQQ-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 3-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-methoxyphenol?
The IUPAC name of sodium 3-methoxyphenol (CID 19079440) is sodium 3-methoxyphenol.
What is the SMILES notation for sodium 3-methoxyphenol?
The canonical SMILES for sodium 3-methoxyphenol is COc1cccc(O)c1.[Na+].
What is the InChIKey of sodium 3-methoxyphenol?
The InChIKey is IIHZUISTNNNXQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.Na/c1-9-7-4-2-3-6(8)5-7;/h2-5,8H,1H3;/q;+1.
What are the key properties of sodium 3-methoxyphenol?
sodium 3-methoxyphenol has a molecular weight of 147.13 g/mol, XLogP of -1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-methoxyphenol is sourced from PubChem (CID 19079440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).