About CID 172849383
CID 172849383 (PubChem CID 172849383) has the molecular formula C8H10NaO2
and a molecular weight of 161.16 g/mol.
Molecular Properties
| Compound Name | CID 172849383 |
| PubChem CID | 172849383 |
| Molecular Formula | C8H10NaO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | — |
| SMILES | COc1cccc(OC)c1.[Na] |
| InChI | InChI=1S/C8H10O2.Na/c1-9-7-4-3-5-8(6-7)10-2;/h3-6H,1-2H3; |
| InChIKey | XWAHZSROKSTQGM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 172849383 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172849383?
The IUPAC name of CID 172849383 (CID 172849383) is not available.
What is the SMILES notation for CID 172849383?
The canonical SMILES for CID 172849383 is COc1cccc(OC)c1.[Na].
What is the InChIKey of CID 172849383?
The InChIKey is XWAHZSROKSTQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.Na/c1-9-7-4-3-5-8(6-7)10-2;/h3-6H,1-2H3;.
What are the key properties of CID 172849383?
CID 172849383 has a molecular weight of 161.16 g/mol, XLogP of 1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172849383 is sourced from PubChem (CID 172849383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).