About azane;1,3-dimethoxybenzene
azane;1,3-dimethoxybenzene (PubChem CID 70210283) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is azane;1,3-dimethoxybenzene.
Molecular Properties
| Compound Name | azane;1,3-dimethoxybenzene |
| PubChem CID | 70210283 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | azane;1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1.N |
| InChI | InChI=1S/C8H10O2.H3N/c1-9-7-4-3-5-8(6-7)10-2;/h3-6H,1-2H3;1H3 |
| InChIKey | PKMUKOVUAGGNTQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;1,3-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,3-dimethoxybenzene?
The IUPAC name of azane;1,3-dimethoxybenzene (CID 70210283) is azane;1,3-dimethoxybenzene.
What is the SMILES notation for azane;1,3-dimethoxybenzene?
The canonical SMILES for azane;1,3-dimethoxybenzene is COc1cccc(OC)c1.N.
What is the InChIKey of azane;1,3-dimethoxybenzene?
The InChIKey is PKMUKOVUAGGNTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.H3N/c1-9-7-4-3-5-8(6-7)10-2;/h3-6H,1-2H3;1H3.
What are the key properties of azane;1,3-dimethoxybenzene?
azane;1,3-dimethoxybenzene has a molecular weight of 155.20 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,3-dimethoxybenzene is sourced from PubChem (CID 70210283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).