C16H20O4 — CID 91359455
1,3-dimethoxybenzene;1,4-dimethoxybenzene (PubChem CID 91359455) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1,3-dimethoxybenzene;1,4-dimethoxybenzene.
| Compound Name | 1,3-dimethoxybenzene;1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 91359455 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1,3-dimethoxybenzene;1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)cc1.COc1cccc(OC)c1 |
| InChI | InChI=1S/2C8H10O2/c1-9-7-3-5-8(10-2)6-4-7;1-9-7-4-3-5-8(6-7)10-2/h2*3-6H,1-2H3 |
| InChIKey | GMDAODGCWAPRJE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |