About CID 139245906
CID 139245906 (PubChem CID 139245906) has the molecular formula C7H7OS
and a molecular weight of 139.20 g/mol.
Molecular Properties
| Compound Name | CID 139245906 |
| PubChem CID | 139245906 |
| Molecular Formula | C7H7OS |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | — |
| SMILES | COc1cccc([S])c1 |
| InChI | InChI=1S/C7H7OS/c1-8-6-3-2-4-7(9)5-6/h2-5H,1H3 |
| InChIKey | AICLZGWMZGNTJN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 139245906 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139245906?
The IUPAC name of CID 139245906 (CID 139245906) is not available.
What is the SMILES notation for CID 139245906?
The canonical SMILES for CID 139245906 is COc1cccc([S])c1.
What is the InChIKey of CID 139245906?
The InChIKey is AICLZGWMZGNTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7OS/c1-8-6-3-2-4-7(9)5-6/h2-5H,1H3.
What are the key properties of CID 139245906?
CID 139245906 has a molecular weight of 139.20 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139245906 is sourced from PubChem (CID 139245906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).