About carbanide;1,3-dimethoxybenzene;rubidium(1+)
carbanide;1,3-dimethoxybenzene;rubidium(1+) (PubChem CID 160752391) has the molecular formula C9H13O2Rb
and a molecular weight of 238.67 g/mol. Its IUPAC name is carbanide;1,3-dimethoxybenzene;rubidium(1+).
Molecular Properties
| Compound Name | carbanide;1,3-dimethoxybenzene;rubidium(1+) |
| PubChem CID | 160752391 |
| Molecular Formula | C9H13O2Rb |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | carbanide;1,3-dimethoxybenzene;rubidium(1+) |
| SMILES | COc1cccc(OC)c1.[CH3-].[Rb+] |
| InChI | InChI=1S/C8H10O2.CH3.Rb/c1-9-7-4-3-5-8(6-7)10-2;;/h3-6H,1-2H3;1H3;/q;-1;+1 |
| InChIKey | KWFLNRSONQSSKJ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1,3-dimethoxybenzene;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1,3-dimethoxybenzene;rubidium(1+)?
The IUPAC name of carbanide;1,3-dimethoxybenzene;rubidium(1+) (CID 160752391) is carbanide;1,3-dimethoxybenzene;rubidium(1+).
What is the SMILES notation for carbanide;1,3-dimethoxybenzene;rubidium(1+)?
The canonical SMILES for carbanide;1,3-dimethoxybenzene;rubidium(1+) is COc1cccc(OC)c1.[CH3-].[Rb+].
What is the InChIKey of carbanide;1,3-dimethoxybenzene;rubidium(1+)?
The InChIKey is KWFLNRSONQSSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.CH3.Rb/c1-9-7-4-3-5-8(6-7)10-2;;/h3-6H,1-2H3;1H3;/q;-1;+1.
What are the key properties of carbanide;1,3-dimethoxybenzene;rubidium(1+)?
carbanide;1,3-dimethoxybenzene;rubidium(1+) has a molecular weight of 238.67 g/mol, XLogP of -0.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1,3-dimethoxybenzene;rubidium(1+) is sourced from PubChem (CID 160752391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).