About calcium;1,3-dimethoxybenzene;hydride
calcium;1,3-dimethoxybenzene;hydride (PubChem CID 174808068) has the molecular formula C8H12CaO2
and a molecular weight of 180.26 g/mol. Its IUPAC name is calcium;1,3-dimethoxybenzene;hydride.
Molecular Properties
| Compound Name | calcium;1,3-dimethoxybenzene;hydride |
| PubChem CID | 174808068 |
| Molecular Formula | C8H12CaO2 |
| Molecular Weight | 180.26 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | calcium;1,3-dimethoxybenzene;hydride |
| SMILES | COc1cccc(OC)c1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C8H10O2.Ca.2H/c1-9-7-4-3-5-8(6-7)10-2;;;/h3-6H,1-2H3;;;/q;+2;2*-1 |
| InChIKey | QYFBUEZEDYIEOO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze calcium;1,3-dimethoxybenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;1,3-dimethoxybenzene;hydride?
The IUPAC name of calcium;1,3-dimethoxybenzene;hydride (CID 174808068) is calcium;1,3-dimethoxybenzene;hydride.
What is the SMILES notation for calcium;1,3-dimethoxybenzene;hydride?
The canonical SMILES for calcium;1,3-dimethoxybenzene;hydride is COc1cccc(OC)c1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;1,3-dimethoxybenzene;hydride?
The InChIKey is QYFBUEZEDYIEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.Ca.2H/c1-9-7-4-3-5-8(6-7)10-2;;;/h3-6H,1-2H3;;;/q;+2;2*-1.
What are the key properties of calcium;1,3-dimethoxybenzene;hydride?
calcium;1,3-dimethoxybenzene;hydride has a molecular weight of 180.26 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;1,3-dimethoxybenzene;hydride is sourced from PubChem (CID 174808068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).