About 3-methoxy-N,N-disilylaniline
3-methoxy-N,N-disilylaniline (PubChem CID 149149494) has the molecular formula C7H13NOSi2
and a molecular weight of 183.36 g/mol. Its IUPAC name is 3-methoxy-N,N-disilylaniline.
Molecular Properties
| Compound Name | 3-methoxy-N,N-disilylaniline |
| PubChem CID | 149149494 |
| Molecular Formula | C7H13NOSi2 |
| Molecular Weight | 183.36 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3-methoxy-N,N-disilylaniline |
| SMILES | COc1cccc(N([SiH3])[SiH3])c1 |
| InChI | InChI=1S/C7H13NOSi2/c1-9-7-4-2-3-6(5-7)8(10)11/h2-5H,1,10-11H3 |
| InChIKey | FMPPSQQVSMZVPO-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.36 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-N,N-disilylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,N-disilylaniline?
The IUPAC name of 3-methoxy-N,N-disilylaniline (CID 149149494) is 3-methoxy-N,N-disilylaniline.
What is the SMILES notation for 3-methoxy-N,N-disilylaniline?
The canonical SMILES for 3-methoxy-N,N-disilylaniline is COc1cccc(N([SiH3])[SiH3])c1.
What is the InChIKey of 3-methoxy-N,N-disilylaniline?
The InChIKey is FMPPSQQVSMZVPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NOSi2/c1-9-7-4-2-3-6(5-7)8(10)11/h2-5H,1,10-11H3.
What are the key properties of 3-methoxy-N,N-disilylaniline?
3-methoxy-N,N-disilylaniline has a molecular weight of 183.36 g/mol, XLogP of -0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,N-disilylaniline is sourced from PubChem (CID 149149494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).