C18H22O4 — CID 101270093
(2S,3S)-2,3-bis(3-methoxyphenyl)butane-2,3-diol (PubChem CID 101270093) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(3-methoxyphenyl)butane-2,3-diol.
| Compound Name | (2S,3S)-2,3-bis(3-methoxyphenyl)butane-2,3-diol |
|---|---|
| PubChem CID | 101270093 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2S,3S)-2,3-bis(3-methoxyphenyl)butane-2,3-diol |
| SMILES | COc1cccc([C@](C)(O)[C@@](C)(O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C18H22O4/c1-17(19,13-7-5-9-15(11-13)21-3)18(2,20)14-8-6-10-16(12-14)22-4/h5-12,19-20H,1-4H3/t17-,18-/m0/s1 |
| InChIKey | KYACXFYHDCXZLL-ROUUACIJSA-N |
| XLogP | 2.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |