C13H17NO2 — CID 79130927
3-hydroxy-3-(3-methoxyphenyl)-2,2-dimethylbutanenitrile (PubChem CID 79130927) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-hydroxy-3-(3-methoxyphenyl)-2,2-dimethylbutanenitrile.
| Compound Name | 3-hydroxy-3-(3-methoxyphenyl)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 79130927 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-hydroxy-3-(3-methoxyphenyl)-2,2-dimethylbutanenitrile |
| SMILES | COc1cccc(C(C)(O)C(C)(C)C#N)c1 |
| InChI | InChI=1S/C13H17NO2/c1-12(2,9-14)13(3,15)10-6-5-7-11(8-10)16-4/h5-8,15H,1-4H3 |
| InChIKey | COSALNIVZLFICS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |