About 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile
3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile (PubChem CID 79129204) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile |
| PubChem CID | 79129204 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile |
| SMILES | Cc1ccc(C(C)(O)C(C)(C)C#N)cc1C |
| InChI | InChI=1S/C14H19NO/c1-10-6-7-12(8-11(10)2)14(5,16)13(3,4)9-15/h6-8,16H,1-5H3 |
| InChIKey | BIFAJPQOGMOUBH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile?
The IUPAC name of 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile (CID 79129204) is 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile.
What is the SMILES notation for 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile?
The canonical SMILES for 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile is Cc1ccc(C(C)(O)C(C)(C)C#N)cc1C.
What is the InChIKey of 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile?
The InChIKey is BIFAJPQOGMOUBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-10-6-7-12(8-11(10)2)14(5,16)13(3,4)9-15/h6-8,16H,1-5H3.
What are the key properties of 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile?
3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile has a molecular weight of 217.31 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)-3-hydroxy-2,2-dimethylbutanenitrile is sourced from PubChem (CID 79129204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).