About 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile
2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile (PubChem CID 116840573) has the molecular formula C13H15F2N
and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile.
Molecular Properties
| Compound Name | 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile |
| PubChem CID | 116840573 |
| Molecular Formula | C13H15F2N |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile |
| SMILES | Cc1ccc(C(C)(C)C)cc1C(F)(F)C#N |
| InChI | InChI=1S/C13H15F2N/c1-9-5-6-10(12(2,3)4)7-11(9)13(14,15)8-16/h5-7H,1-4H3 |
| InChIKey | HFVPURGDSTWYRM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile?
The IUPAC name of 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile (CID 116840573) is 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile.
What is the SMILES notation for 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile?
The canonical SMILES for 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile is Cc1ccc(C(C)(C)C)cc1C(F)(F)C#N.
What is the InChIKey of 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile?
The InChIKey is HFVPURGDSTWYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N/c1-9-5-6-10(12(2,3)4)7-11(9)13(14,15)8-16/h5-7H,1-4H3.
What are the key properties of 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile?
2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile has a molecular weight of 223.27 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-tert-butyl-2-methylphenyl)-2,2-difluoroacetonitrile is sourced from PubChem (CID 116840573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).