C12H15F3 — CID 147910906
4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene (PubChem CID 147910906) has the molecular formula C12H15F3 and a molecular weight of 216.25 g/mol. Its IUPAC name is 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene.
| Compound Name | 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene |
|---|---|
| PubChem CID | 147910906 |
| Molecular Formula | C12H15F3 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene |
| SMILES | CC(C)(C)c1ccc(F)c(C(C)(F)F)c1 |
| InChI | InChI=1S/C12H15F3/c1-11(2,3)8-5-6-10(13)9(7-8)12(4,14)15/h5-7H,1-4H3 |
| InChIKey | IGCLEOSPCJRYQL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |