About 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene
4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene (PubChem CID 147910906) has the molecular formula C12H15F3
and a molecular weight of 216.25 g/mol. Its IUPAC name is 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene.
Molecular Properties
| Compound Name | 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene |
| PubChem CID | 147910906 |
| Molecular Formula | C12H15F3 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene |
| SMILES | CC(C)(C)c1ccc(F)c(C(C)(F)F)c1 |
| InChI | InChI=1S/C12H15F3/c1-11(2,3)8-5-6-10(13)9(7-8)12(4,14)15/h5-7H,1-4H3 |
| InChIKey | IGCLEOSPCJRYQL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene?
The IUPAC name of 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene (CID 147910906) is 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene.
What is the SMILES notation for 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene?
The canonical SMILES for 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene is CC(C)(C)c1ccc(F)c(C(C)(F)F)c1.
What is the InChIKey of 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene?
The InChIKey is IGCLEOSPCJRYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3/c1-11(2,3)8-5-6-10(13)9(7-8)12(4,14)15/h5-7H,1-4H3.
What are the key properties of 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene?
4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene has a molecular weight of 216.25 g/mol, XLogP of 4.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-(1,1-difluoroethyl)-1-fluorobenzene is sourced from PubChem (CID 147910906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).