C13H15ClF4 — CID 107290343
4-(4-chloro-2-methylpentan-2-yl)-1-fluoro-2-(trifluoromethyl)benzene (PubChem CID 107290343) has the molecular formula C13H15ClF4 and a molecular weight of 282.71 g/mol. Its IUPAC name is 4-(4-chloro-2-methylpentan-2-yl)-1-fluoro-2-(trifluoromethyl)benzene.
| Compound Name | 4-(4-chloro-2-methylpentan-2-yl)-1-fluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 107290343 |
| Molecular Formula | C13H15ClF4 |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(4-chloro-2-methylpentan-2-yl)-1-fluoro-2-(trifluoromethyl)benzene |
| SMILES | CC(Cl)CC(C)(C)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15ClF4/c1-8(14)7-12(2,3)9-4-5-11(15)10(6-9)13(16,17)18/h4-6,8H,7H2,1-3H3 |
| InChIKey | GAPRMBIBWFVOAE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|