C13H13ClF4O2 — CID 145156762
4-chloro-2-[2-fluoro-4-(trifluoromethyl)phenyl]-2-methylpentanoic acid (PubChem CID 145156762) has the molecular formula C13H13ClF4O2 and a molecular weight of 312.69 g/mol. Its IUPAC name is 4-chloro-2-[2-fluoro-4-(trifluoromethyl)phenyl]-2-methylpentanoic acid.
| Compound Name | 4-chloro-2-[2-fluoro-4-(trifluoromethyl)phenyl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 145156762 |
| Molecular Formula | C13H13ClF4O2 |
| Molecular Weight | 312.69 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-chloro-2-[2-fluoro-4-(trifluoromethyl)phenyl]-2-methylpentanoic acid |
| SMILES | CC(Cl)CC(C)(C(=O)O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C13H13ClF4O2/c1-7(14)6-12(2,11(19)20)9-4-3-8(5-10(9)15)13(16,17)18/h3-5,7H,6H2,1-2H3,(H,19,20) |
| InChIKey | KTZCXJADLUMOLW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|