C12H12F2O4 — CID 117050132
2-(2,4-difluorophenyl)-2-methylpentanedioic acid (PubChem CID 117050132) has the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-methylpentanedioic acid.
| Compound Name | 2-(2,4-difluorophenyl)-2-methylpentanedioic acid |
|---|---|
| PubChem CID | 117050132 |
| Molecular Formula | C12H12F2O4 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-methylpentanedioic acid |
| SMILES | CC(CCC(=O)O)(C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H12F2O4/c1-12(11(17)18,5-4-10(15)16)8-3-2-7(13)6-9(8)14/h2-3,6H,4-5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | TVKCWEIDYYGCTL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |