C10H7F5O2 — CID 103303089
4,4-difluoro-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 103303089) has the molecular formula C10H7F5O2 and a molecular weight of 254.15 g/mol. Its IUPAC name is 4,4-difluoro-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | 4,4-difluoro-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 103303089 |
| Molecular Formula | C10H7F5O2 |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4,4-difluoro-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | O=C(O)CCC(F)(F)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H7F5O2/c11-6-4-8(13)7(12)3-5(6)10(14,15)2-1-9(16)17/h3-4H,1-2H2,(H,16,17) |
| InChIKey | JHEQTBSHNNBFRN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|