5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid

C13H15F3O4 — CID 62866050

IUPAC5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid
SMILESCOc1cc(F)c(C(F)(F)CCCC(=O)O)cc1OC
InChIInChI=1S/C13H15F3O4/c1-19-10-6-8(9(14)7-11(10)20-2)13(15,16)5-3-4-12(17)18/h6-7H,3-5H2,1-2H3,(H,17,18)
InChIKeyGXOWRCKTLSNPKR-UHFFFAOYSA-N
MW292.25 g/mol
LogP3.19
Rot. Bonds7

About 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid

5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid (PubChem CID 62866050) has the molecular formula C13H15F3O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid.

Molecular Properties

Compound Name5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid
PubChem CID62866050
Molecular FormulaC13H15F3O4
Molecular Weight292.25 g/mol
Exact Mass292.09
IUPAC Name5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid
SMILESCOc1cc(F)c(C(F)(F)CCCC(=O)O)cc1OC
InChIInChI=1S/C13H15F3O4/c1-19-10-6-8(9(14)7-11(10)20-2)13(15,16)5-3-4-12(17)18/h6-7H,3-5H2,1-2H3,(H,17,18)
InChIKeyGXOWRCKTLSNPKR-UHFFFAOYSA-N
XLogP3.19
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.25
LogP ≤ 53.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid?
The IUPAC name of 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid (CID 62866050) is 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid.
What is the SMILES notation for 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid?
The canonical SMILES for 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid is COc1cc(F)c(C(F)(F)CCCC(=O)O)cc1OC.
What is the InChIKey of 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid?
The InChIKey is GXOWRCKTLSNPKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O4/c1-19-10-6-8(9(14)7-11(10)20-2)13(15,16)5-3-4-12(17)18/h6-7H,3-5H2,1-2H3,(H,17,18).
What are the key properties of 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid?
5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid has a molecular weight of 292.25 g/mol, XLogP of 3.19, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-5-(2-fluoro-4,5-dimethoxyphenyl)pentanoic acid is sourced from PubChem (CID 62866050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).