5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid

C12H12ClF3O2 — CID 81045687

IUPAC5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid
SMILESCc1cc(C(F)(F)CCCC(=O)O)c(Cl)cc1F
InChIInChI=1S/C12H12ClF3O2/c1-7-5-8(9(13)6-10(7)14)12(15,16)4-2-3-11(17)18/h5-6H,2-4H2,1H3,(H,17,18)
InChIKeySYDKYASOTYLZJH-UHFFFAOYSA-N
MW280.67 g/mol
LogP4.13
Rot. Bonds5

About 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid

5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid (PubChem CID 81045687) has the molecular formula C12H12ClF3O2 and a molecular weight of 280.67 g/mol. Its IUPAC name is 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid.

Molecular Properties

Compound Name5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid
PubChem CID81045687
Molecular FormulaC12H12ClF3O2
Molecular Weight280.67 g/mol
Exact Mass280.05
IUPAC Name5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid
SMILESCc1cc(C(F)(F)CCCC(=O)O)c(Cl)cc1F
InChIInChI=1S/C12H12ClF3O2/c1-7-5-8(9(13)6-10(7)14)12(15,16)4-2-3-11(17)18/h5-6H,2-4H2,1H3,(H,17,18)
InChIKeySYDKYASOTYLZJH-UHFFFAOYSA-N
XLogP4.13
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.67
LogP ≤ 54.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid?
The IUPAC name of 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid (CID 81045687) is 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid.
What is the SMILES notation for 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid?
The canonical SMILES for 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid is Cc1cc(C(F)(F)CCCC(=O)O)c(Cl)cc1F.
What is the InChIKey of 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid?
The InChIKey is SYDKYASOTYLZJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClF3O2/c1-7-5-8(9(13)6-10(7)14)12(15,16)4-2-3-11(17)18/h5-6H,2-4H2,1H3,(H,17,18).
What are the key properties of 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid?
5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid has a molecular weight of 280.67 g/mol, XLogP of 4.13, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-4-fluoro-5-methylphenyl)-5,5-difluoropentanoic acid is sourced from PubChem (CID 81045687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).