5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid

C13H15ClF2O2 — CID 115484263

IUPAC5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid
SMILESCc1cc(Cl)c(C(F)(F)CCCC(=O)O)cc1C
InChIInChI=1S/C13H15ClF2O2/c1-8-6-10(11(14)7-9(8)2)13(15,16)5-3-4-12(17)18/h6-7H,3-5H2,1-2H3,(H,17,18)
InChIKeyDUSKFDCAQVVZTH-UHFFFAOYSA-N
MW276.71 g/mol
LogP4.30
Rot. Bonds5

About 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid

5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid (PubChem CID 115484263) has the molecular formula C13H15ClF2O2 and a molecular weight of 276.71 g/mol. Its IUPAC name is 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid.

Molecular Properties

Compound Name5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid
PubChem CID115484263
Molecular FormulaC13H15ClF2O2
Molecular Weight276.71 g/mol
Exact Mass276.07
IUPAC Name5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid
SMILESCc1cc(Cl)c(C(F)(F)CCCC(=O)O)cc1C
InChIInChI=1S/C13H15ClF2O2/c1-8-6-10(11(14)7-9(8)2)13(15,16)5-3-4-12(17)18/h6-7H,3-5H2,1-2H3,(H,17,18)
InChIKeyDUSKFDCAQVVZTH-UHFFFAOYSA-N
XLogP4.30
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.71
LogP ≤ 54.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid?
The IUPAC name of 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid (CID 115484263) is 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid.
What is the SMILES notation for 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid?
The canonical SMILES for 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid is Cc1cc(Cl)c(C(F)(F)CCCC(=O)O)cc1C.
What is the InChIKey of 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid?
The InChIKey is DUSKFDCAQVVZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClF2O2/c1-8-6-10(11(14)7-9(8)2)13(15,16)5-3-4-12(17)18/h6-7H,3-5H2,1-2H3,(H,17,18).
What are the key properties of 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid?
5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid has a molecular weight of 276.71 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid is sourced from PubChem (CID 115484263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).