C13H15ClF2O2 — CID 115484263
5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid (PubChem CID 115484263) has the molecular formula C13H15ClF2O2 and a molecular weight of 276.71 g/mol. Its IUPAC name is 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid.
| Compound Name | 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid |
|---|---|
| PubChem CID | 115484263 |
| Molecular Formula | C13H15ClF2O2 |
| Molecular Weight | 276.71 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-(2-chloro-4,5-dimethylphenyl)-5,5-difluoropentanoic acid |
| SMILES | Cc1cc(Cl)c(C(F)(F)CCCC(=O)O)cc1C |
| InChI | InChI=1S/C13H15ClF2O2/c1-8-6-10(11(14)7-9(8)2)13(15,16)5-3-4-12(17)18/h6-7H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | DUSKFDCAQVVZTH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |