3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid

C13H17ClO2 — CID 115485104

IUPAC3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid
SMILESCc1cc(Cl)c(C(C)(C)CC(=O)O)cc1C
InChIInChI=1S/C13H17ClO2/c1-8-5-10(11(14)6-9(8)2)13(3,4)7-12(15)16/h5-6H,7H2,1-4H3,(H,15,16)
InChIKeyRJKABROCFWRWEG-UHFFFAOYSA-N
MW240.73 g/mol
LogP3.71
Rot. Bonds3

About 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid

3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid (PubChem CID 115485104) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid.

Molecular Properties

Compound Name3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid
PubChem CID115485104
Molecular FormulaC13H17ClO2
Molecular Weight240.73 g/mol
Exact Mass240.09
IUPAC Name3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid
SMILESCc1cc(Cl)c(C(C)(C)CC(=O)O)cc1C
InChIInChI=1S/C13H17ClO2/c1-8-5-10(11(14)6-9(8)2)13(3,4)7-12(15)16/h5-6H,7H2,1-4H3,(H,15,16)
InChIKeyRJKABROCFWRWEG-UHFFFAOYSA-N
XLogP3.71
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.73
LogP ≤ 53.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid?
The IUPAC name of 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid (CID 115485104) is 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid.
What is the SMILES notation for 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid?
The canonical SMILES for 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid is Cc1cc(Cl)c(C(C)(C)CC(=O)O)cc1C.
What is the InChIKey of 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid?
The InChIKey is RJKABROCFWRWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO2/c1-8-5-10(11(14)6-9(8)2)13(3,4)7-12(15)16/h5-6H,7H2,1-4H3,(H,15,16).
What are the key properties of 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid?
3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid has a molecular weight of 240.73 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4,5-dimethylphenyl)-3-methylbutanoic acid is sourced from PubChem (CID 115485104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).