C12H12ClF3O3 — CID 117477877
3-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]-3-methylbutanoic acid (PubChem CID 117477877) has the molecular formula C12H12ClF3O3 and a molecular weight of 296.67 g/mol. Its IUPAC name is 3-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]-3-methylbutanoic acid.
| Compound Name | 3-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117477877 |
| Molecular Formula | C12H12ClF3O3 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1cc(C(F)(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C12H12ClF3O3/c1-11(2,5-9(17)18)7-3-6(12(14,15)16)4-8(13)10(7)19/h3-4,19H,5H2,1-2H3,(H,17,18) |
| InChIKey | FUKCNZQVCHSIOJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |