C10H8ClF3O3 — CID 117424985
2-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 117424985) has the molecular formula C10H8ClF3O3 and a molecular weight of 268.62 g/mol. Its IUPAC name is 2-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117424985 |
| Molecular Formula | C10H8ClF3O3 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1cc(C(F)(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C10H8ClF3O3/c1-4(9(16)17)6-2-5(10(12,13)14)3-7(11)8(6)15/h2-4,15H,1H3,(H,16,17) |
| InChIKey | PMXSWWDZVZGXCE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |