C15H21NO4 — CID 174507724
2-(5-tert-butyl-2-hydroxy-3-methylphenyl)propanoic acid;isocyanic acid (PubChem CID 174507724) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-hydroxy-3-methylphenyl)propanoic acid;isocyanic acid.
| Compound Name | 2-(5-tert-butyl-2-hydroxy-3-methylphenyl)propanoic acid;isocyanic acid |
|---|---|
| PubChem CID | 174507724 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(5-tert-butyl-2-hydroxy-3-methylphenyl)propanoic acid;isocyanic acid |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)C(=O)O)c1O.N=C=O |
| InChI | InChI=1S/C14H20O3.CHNO/c1-8-6-10(14(3,4)5)7-11(12(8)15)9(2)13(16)17;2-1-3/h6-7,9,15H,1-5H3,(H,16,17);2H |
| InChIKey | RPDFICPOXKNVPY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|