C22H30O2S2 — CID 12712019
4-tert-butyl-2-[(5-tert-butyl-2-hydroxy-3-methylphenyl)disulfanyl]-6-methylphenol (PubChem CID 12712019) has the molecular formula C22H30O2S2 and a molecular weight of 390.61 g/mol. Its IUPAC name is 4-tert-butyl-2-[(5-tert-butyl-2-hydroxy-3-methylphenyl)disulfanyl]-6-methylphenol.
| Compound Name | 4-tert-butyl-2-[(5-tert-butyl-2-hydroxy-3-methylphenyl)disulfanyl]-6-methylphenol |
|---|---|
| PubChem CID | 12712019 |
| Molecular Formula | C22H30O2S2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-tert-butyl-2-[(5-tert-butyl-2-hydroxy-3-methylphenyl)disulfanyl]-6-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)cc(SSc2cc(C(C)(C)C)cc(C)c2O)c1O |
| InChI | InChI=1S/C22H30O2S2/c1-13-9-15(21(3,4)5)11-17(19(13)23)25-26-18-12-16(22(6,7)8)10-14(2)20(18)24/h9-12,23-24H,1-8H3 |
| InChIKey | VHUISYRPKUFPBB-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|