C11H16O3S — CID 59289695
5-tert-butyl-2-hydroxy-3-methylbenzenesulfinic acid (PubChem CID 59289695) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is 5-tert-butyl-2-hydroxy-3-methylbenzenesulfinic acid.
| Compound Name | 5-tert-butyl-2-hydroxy-3-methylbenzenesulfinic acid |
|---|---|
| PubChem CID | 59289695 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 5-tert-butyl-2-hydroxy-3-methylbenzenesulfinic acid |
| SMILES | Cc1cc(C(C)(C)C)cc(S(=O)O)c1O |
| InChI | InChI=1S/C11H16O3S/c1-7-5-8(11(2,3)4)6-9(10(7)12)15(13)14/h5-6,12H,1-4H3,(H,13,14) |
| InChIKey | AAEDYLYNWCESQF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|