C12H17O2S- — CID 123340986
4-tert-butyl-2,6-dimethylbenzenesulfinate (PubChem CID 123340986) has the molecular formula C12H17O2S- and a molecular weight of 225.33 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethylbenzenesulfinate.
| Compound Name | 4-tert-butyl-2,6-dimethylbenzenesulfinate |
|---|---|
| PubChem CID | 123340986 |
| Molecular Formula | C12H17O2S- |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-tert-butyl-2,6-dimethylbenzenesulfinate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)[O-] |
| InChI | InChI=1S/C12H18O2S/c1-8-6-10(12(3,4)5)7-9(2)11(8)15(13)14/h6-7H,1-5H3,(H,13,14)/p-1 |
| InChIKey | DVZBKRZSGCEPFL-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|