C9H11O4S- — CID 57323633
2,6-dimethoxy-4-methylbenzenesulfinate (PubChem CID 57323633) has the molecular formula C9H11O4S- and a molecular weight of 215.25 g/mol. Its IUPAC name is 2,6-dimethoxy-4-methylbenzenesulfinate.
| Compound Name | 2,6-dimethoxy-4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 57323633 |
| Molecular Formula | C9H11O4S- |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2,6-dimethoxy-4-methylbenzenesulfinate |
| SMILES | COc1cc(C)cc(OC)c1S(=O)[O-] |
| InChI | InChI=1S/C9H12O4S/c1-6-4-7(12-2)9(14(10)11)8(5-6)13-3/h4-5H,1-3H3,(H,10,11)/p-1 |
| InChIKey | PKWYAKIJZGZUNV-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|