C9H11O5S- — CID 67493178
2,3,5-trimethoxybenzenesulfinate (PubChem CID 67493178) has the molecular formula C9H11O5S- and a molecular weight of 231.25 g/mol. Its IUPAC name is 2,3,5-trimethoxybenzenesulfinate.
| Compound Name | 2,3,5-trimethoxybenzenesulfinate |
|---|---|
| PubChem CID | 67493178 |
| Molecular Formula | C9H11O5S- |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2,3,5-trimethoxybenzenesulfinate |
| SMILES | COc1cc(OC)c(OC)c(S(=O)[O-])c1 |
| InChI | InChI=1S/C9H12O5S/c1-12-6-4-7(13-2)9(14-3)8(5-6)15(10)11/h4-5H,1-3H3,(H,10,11)/p-1 |
| InChIKey | KLHVIYZBHJKEET-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|