C9H11NaO5S — CID 23675416
sodium 3,4,5-trimethoxybenzenesulfinate (PubChem CID 23675416) has the molecular formula C9H11NaO5S and a molecular weight of 254.24 g/mol. Its IUPAC name is sodium 3,4,5-trimethoxybenzenesulfinate.
| Compound Name | sodium 3,4,5-trimethoxybenzenesulfinate |
|---|---|
| PubChem CID | 23675416 |
| Molecular Formula | C9H11NaO5S |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | sodium 3,4,5-trimethoxybenzenesulfinate |
| SMILES | COc1cc(S(=O)[O-])cc(OC)c1OC.[Na+] |
| InChI | InChI=1S/C9H12O5S.Na/c1-12-7-4-6(15(10)11)5-8(13-2)9(7)14-3;/h4-5H,1-3H3,(H,10,11);/q;+1/p-1 |
| InChIKey | OCXVMFUWBBHUMT-UHFFFAOYSA-M |
| XLogP | -2.05 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|