C17H20O5S — CID 10215306
1,2,3-trimethoxy-5-[(4-methoxyphenyl)methylsulfinyl]benzene (PubChem CID 10215306) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(4-methoxyphenyl)methylsulfinyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(4-methoxyphenyl)methylsulfinyl]benzene |
|---|---|
| PubChem CID | 10215306 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(4-methoxyphenyl)methylsulfinyl]benzene |
| SMILES | COc1ccc(CS(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H20O5S/c1-19-13-7-5-12(6-8-13)11-23(18)14-9-15(20-2)17(22-4)16(10-14)21-3/h5-10H,11H2,1-4H3 |
| InChIKey | RIXQNAIUGKLRMK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |