C15H15KO5S2 — CID 102506538
potassium [4-[(4-methoxyphenyl)methylsulfinyl]phenyl]methanesulfonate (PubChem CID 102506538) has the molecular formula C15H15KO5S2 and a molecular weight of 378.51 g/mol. Its IUPAC name is potassium [4-[(4-methoxyphenyl)methylsulfinyl]phenyl]methanesulfonate.
| Compound Name | potassium [4-[(4-methoxyphenyl)methylsulfinyl]phenyl]methanesulfonate |
|---|---|
| PubChem CID | 102506538 |
| Molecular Formula | C15H15KO5S2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | potassium [4-[(4-methoxyphenyl)methylsulfinyl]phenyl]methanesulfonate |
| SMILES | COc1ccc(CS(=O)c2ccc(CS(=O)(=O)[O-])cc2)cc1.[K+] |
| InChI | InChI=1S/C15H16O5S2.K/c1-20-14-6-2-12(3-7-14)10-21(16)15-8-4-13(5-9-15)11-22(17,18)19;/h2-9H,10-11H2,1H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | FMZBBADOVMXJPM-UHFFFAOYSA-M |
| XLogP | -0.95 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|