C26H30N2O5S — CID 5201041
3-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 5201041) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 3-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 5201041 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2cc(OC)c(OC)c(OC)c2)C(=S)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O5S/c1-29-21-10-6-18(7-11-21)16-28(26(34)27-20-8-12-22(30-2)13-9-20)17-19-14-23(31-3)25(33-5)24(15-19)32-4/h6-15H,16-17H2,1-5H3,(H,27,34) |
| InChIKey | CPLZEAUZOJNFEJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|