C23H22Cl2N2O2S — CID 4104242
1-[(2,4-dichlorophenyl)methyl]-3-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 4104242) has the molecular formula C23H22Cl2N2O2S and a molecular weight of 461.41 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 4104242 |
| Molecular Formula | C23H22Cl2N2O2S |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2ccc(Cl)cc2Cl)C(=S)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O2S/c1-28-20-9-3-16(4-10-20)14-27(15-17-5-6-18(24)13-22(17)25)23(30)26-19-7-11-21(29-2)12-8-19/h3-13H,14-15H2,1-2H3,(H,26,30) |
| InChIKey | RZLWZUMBFKIHSQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|