C25H28N2O2S — CID 4983571
3-(4-ethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]thiourea (PubChem CID 4983571) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]thiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 4983571 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2ccc(C)cc2)Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O2S/c1-4-29-24-15-11-22(12-16-24)26-25(30)27(17-20-7-5-19(2)6-8-20)18-21-9-13-23(28-3)14-10-21/h5-16H,4,17-18H2,1-3H3,(H,26,30) |
| InChIKey | ROYZVLBUAZQKDY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|