C13H20N2O3S — CID 23855801
3-(4-ethoxyphenyl)-1,1-bis(2-hydroxyethyl)thiourea (PubChem CID 23855801) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1,1-bis(2-hydroxyethyl)thiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1,1-bis(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 23855801 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1,1-bis(2-hydroxyethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CCO)CCO)cc1 |
| InChI | InChI=1S/C13H20N2O3S/c1-2-18-12-5-3-11(4-6-12)14-13(19)15(7-9-16)8-10-17/h3-6,16-17H,2,7-10H2,1H3,(H,14,19) |
| InChIKey | BRVXHUQRNZPQGR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|