C19H24N4O2S2 — CID 2370211
3-(4-ethoxyphenyl)-1-[(4-ethoxyphenyl)carbamothioylamino]-1-methylthiourea (PubChem CID 2370211) has the molecular formula C19H24N4O2S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[(4-ethoxyphenyl)carbamothioylamino]-1-methylthiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1-[(4-ethoxyphenyl)carbamothioylamino]-1-methylthiourea |
|---|---|
| PubChem CID | 2370211 |
| Molecular Formula | C19H24N4O2S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[(4-ethoxyphenyl)carbamothioylamino]-1-methylthiourea |
| SMILES | CCOc1ccc(NC(=S)NN(C)C(=S)Nc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C19H24N4O2S2/c1-4-24-16-10-6-14(7-11-16)20-18(26)22-23(3)19(27)21-15-8-12-17(13-9-15)25-5-2/h6-13H,4-5H2,1-3H3,(H,21,27)(H2,20,22,26) |
| InChIKey | FULKVJOQCNRHDQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|