C19H24N2OS — CID 9217139
3-(4-methoxyphenyl)-1-[(4-methylphenyl)methyl]-1-propylthiourea (PubChem CID 9217139) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[(4-methylphenyl)methyl]-1-propylthiourea.
| Compound Name | 3-(4-methoxyphenyl)-1-[(4-methylphenyl)methyl]-1-propylthiourea |
|---|---|
| PubChem CID | 9217139 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[(4-methylphenyl)methyl]-1-propylthiourea |
| SMILES | CCCN(Cc1ccc(C)cc1)C(=S)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H24N2OS/c1-4-13-21(14-16-7-5-15(2)6-8-16)19(23)20-17-9-11-18(22-3)12-10-17/h5-12H,4,13-14H2,1-3H3,(H,20,23) |
| InChIKey | IJGCNGWGSXWZAE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|