C25H27ClN2OS — CID 4173822
3-(4-chlorophenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea (PubChem CID 4173822) has the molecular formula C25H27ClN2OS and a molecular weight of 439.02 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea.
| Compound Name | 3-(4-chlorophenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 4173822 |
| Molecular Formula | C25H27ClN2OS |
| Molecular Weight | 439.02 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2ccc(C(C)C)cc2)C(=S)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H27ClN2OS/c1-18(2)21-8-4-19(5-9-21)16-28(17-20-6-14-24(29-3)15-7-20)25(30)27-23-12-10-22(26)11-13-23/h4-15,18H,16-17H2,1-3H3,(H,27,30) |
| InChIKey | SZAVUJIONYKMAP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.02 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|