C27H32N2O3S — CID 4282784
3-(2,4-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea (PubChem CID 4282784) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 4282784 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2ccc(C(C)C)cc2)C(=S)Nc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C27H32N2O3S/c1-19(2)22-10-6-20(7-11-22)17-29(18-21-8-12-23(30-3)13-9-21)27(33)28-25-15-14-24(31-4)16-26(25)32-5/h6-16,19H,17-18H2,1-5H3,(H,28,33) |
| InChIKey | FDFWBIDYKPPGIV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|