C24H30N2O3S — CID 4668710
1-(cyclohex-3-en-1-ylmethyl)-3-(2,4-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 4668710) has the molecular formula C24H30N2O3S and a molecular weight of 426.58 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-3-(2,4-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-3-(2,4-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 4668710 |
| Molecular Formula | C24H30N2O3S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-3-(2,4-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(CC2CC=CCC2)C(=S)Nc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H30N2O3S/c1-27-20-11-9-19(10-12-20)17-26(16-18-7-5-4-6-8-18)24(30)25-22-14-13-21(28-2)15-23(22)29-3/h4-5,9-15,18H,6-8,16-17H2,1-3H3,(H,25,30) |
| InChIKey | GWRQUNRSQTXSKC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|