C20H27ClN2O2S — CID 40612979
3-(4-chloro-2-methoxyphenyl)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 40612979) has the molecular formula C20H27ClN2O2S and a molecular weight of 394.97 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxyphenyl)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 3-(4-chloro-2-methoxyphenyl)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 40612979 |
| Molecular Formula | C20H27ClN2O2S |
| Molecular Weight | 394.97 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-(4-chloro-2-methoxyphenyl)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1cc(Cl)ccc1NC(=S)N(C[C@H]1CC=CCC1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H27ClN2O2S/c1-24-19-12-16(21)9-10-18(19)22-20(26)23(14-17-8-5-11-25-17)13-15-6-3-2-4-7-15/h2-3,9-10,12,15,17H,4-8,11,13-14H2,1H3,(H,22,26)/t15-,17+/m0/s1 |
| InChIKey | INQNCUUNFSIQNJ-DOTOQJQBSA-N |
| XLogP | 4.88 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.97 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|