C19H20Cl2N2O2S — CID 42996167
3-(2,4-dichlorophenyl)-1-[(2-hydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 42996167) has the molecular formula C19H20Cl2N2O2S and a molecular weight of 411.35 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-[(2-hydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(2,4-dichlorophenyl)-1-[(2-hydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 42996167 |
| Molecular Formula | C19H20Cl2N2O2S |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-[(2-hydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Oc1ccccc1CN(CC1CCCO1)C(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O2S/c20-14-7-8-17(16(21)10-14)22-19(26)23(12-15-5-3-9-25-15)11-13-4-1-2-6-18(13)24/h1-2,4,6-8,10,15,24H,3,5,9,11-12H2,(H,22,26) |
| InChIKey | ZOOXHWRQMVORSG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|