C19H22ClN3O2S — CID 40608397
3-(4-chloro-2-methoxyphenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 40608397) has the molecular formula C19H22ClN3O2S and a molecular weight of 391.92 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxyphenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 3-(4-chloro-2-methoxyphenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 40608397 |
| Molecular Formula | C19H22ClN3O2S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-(4-chloro-2-methoxyphenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | COc1cc(Cl)ccc1NC(=S)N(Cc1ccncc1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C19H22ClN3O2S/c1-24-18-11-15(20)4-5-17(18)22-19(26)23(13-16-3-2-10-25-16)12-14-6-8-21-9-7-14/h4-9,11,16H,2-3,10,12-13H2,1H3,(H,22,26)/t16-/m1/s1 |
| InChIKey | SGICZQSJINKBOF-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|