C18H19ClFN3OS — CID 40569571
3-(3-chloro-4-fluorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 40569571) has the molecular formula C18H19ClFN3OS and a molecular weight of 379.89 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 40569571 |
| Molecular Formula | C18H19ClFN3OS |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | Fc1ccc(NC(=S)N(Cc2ccncc2)C[C@@H]2CCCO2)cc1Cl |
| InChI | InChI=1S/C18H19ClFN3OS/c19-16-10-14(3-4-17(16)20)22-18(25)23(12-15-2-1-9-24-15)11-13-5-7-21-8-6-13/h3-8,10,15H,1-2,9,11-12H2,(H,22,25)/t15-/m0/s1 |
| InChIKey | NGXMBHGHVLSABF-HNNXBMFYSA-N |
| XLogP | 4.25 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|