C18H21ClN2OS2 — CID 7988183
3-(3-chloro-4-methylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 7988183) has the molecular formula C18H21ClN2OS2 and a molecular weight of 380.97 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 7988183 |
| Molecular Formula | C18H21ClN2OS2 |
| Molecular Weight | 380.97 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2cccs2)C[C@@H]2CCCO2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2OS2/c1-13-6-7-14(10-17(13)19)20-18(23)21(11-15-4-2-8-22-15)12-16-5-3-9-24-16/h3,5-7,9-10,15H,2,4,8,11-12H2,1H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | KYCLGHQYVBBHSM-HNNXBMFYSA-N |
| XLogP | 5.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.97 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|