C17H19FN2OS2 — CID 7988241
3-(4-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 7988241) has the molecular formula C17H19FN2OS2 and a molecular weight of 350.48 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(4-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 7988241 |
| Molecular Formula | C17H19FN2OS2 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Fc1ccc(NC(=S)N(Cc2cccs2)C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C17H19FN2OS2/c18-13-5-7-14(8-6-13)19-17(22)20(11-15-3-1-9-21-15)12-16-4-2-10-23-16/h2,4-8,10,15H,1,3,9,11-12H2,(H,19,22)/t15-/m1/s1 |
| InChIKey | JIFBFCUWBTXUEV-OAHLLOKOSA-N |
| XLogP | 4.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|