C18H21ClN2O2S2 — CID 28762030
3-(2-chloro-4-methoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 28762030) has the molecular formula C18H21ClN2O2S2 and a molecular weight of 396.97 g/mol. Its IUPAC name is 3-(2-chloro-4-methoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(2-chloro-4-methoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 28762030 |
| Molecular Formula | C18H21ClN2O2S2 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 3-(2-chloro-4-methoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2cccs2)C[C@@H]2CCCO2)c(Cl)c1 |
| InChI | InChI=1S/C18H21ClN2O2S2/c1-22-13-6-7-17(16(19)10-13)20-18(24)21(11-14-4-2-8-23-14)12-15-5-3-9-25-15/h3,5-7,9-10,14H,2,4,8,11-12H2,1H3,(H,20,24)/t14-/m0/s1 |
| InChIKey | WQZINVZXHJVBAU-AWEZNQCLSA-N |
| XLogP | 4.79 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|