C19H25FN3OS2+ — CID 8675644
3-(4-fluorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 8675644) has the molecular formula C19H25FN3OS2+ and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(4-fluorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8675644 |
| Molecular Formula | C19H25FN3OS2+ |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Fc1ccc(NC(=S)N(CCC[NH+]2CCOCC2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C19H24FN3OS2/c20-16-4-6-17(7-5-16)21-19(25)23(15-18-3-1-14-26-18)9-2-8-22-10-12-24-13-11-22/h1,3-7,14H,2,8-13,15H2,(H,21,25)/p+1 |
| InChIKey | GSRRLIDAYUNXED-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|